C13H9BrF4N2 — CID 65435093
1-N-(4-bromo-3-fluorophenyl)-4-(trifluoromethyl)benzene-1,2-diamine (PubChem CID 65435093) has the molecular formula C13H9BrF4N2 and a molecular weight of 349.13 g/mol. Its IUPAC name is 1-N-(4-bromo-3-fluorophenyl)-4-(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | 1-N-(4-bromo-3-fluorophenyl)-4-(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65435093 |
| Molecular Formula | C13H9BrF4N2 |
| Molecular Weight | 349.13 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 1-N-(4-bromo-3-fluorophenyl)-4-(trifluoromethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(C(F)(F)F)ccc1Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C13H9BrF4N2/c14-9-3-2-8(6-10(9)15)20-12-4-1-7(5-11(12)19)13(16,17)18/h1-6,20H,19H2 |
| InChIKey | ASPWPASZWNASLQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.13 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|