C12H8BrClF2N2 — CID 66078253
1-N-(4-bromo-3-fluorophenyl)-4-chloro-5-fluorobenzene-1,2-diamine (PubChem CID 66078253) has the molecular formula C12H8BrClF2N2 and a molecular weight of 333.56 g/mol. Its IUPAC name is 1-N-(4-bromo-3-fluorophenyl)-4-chloro-5-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-(4-bromo-3-fluorophenyl)-4-chloro-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 66078253 |
| Molecular Formula | C12H8BrClF2N2 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 1-N-(4-bromo-3-fluorophenyl)-4-chloro-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(F)cc1Nc1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H8BrClF2N2/c13-7-2-1-6(3-9(7)15)18-12-5-10(16)8(14)4-11(12)17/h1-5,18H,17H2 |
| InChIKey | OMSLTMJOPOVIEA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|