C14H8ClFN4 — CID 107787128
4-(2-amino-4-chloro-5-fluoroanilino)benzene-1,2-dicarbonitrile (PubChem CID 107787128) has the molecular formula C14H8ClFN4 and a molecular weight of 286.70 g/mol. Its IUPAC name is 4-(2-amino-4-chloro-5-fluoroanilino)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(2-amino-4-chloro-5-fluoroanilino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107787128 |
| Molecular Formula | C14H8ClFN4 |
| Molecular Weight | 286.70 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-(2-amino-4-chloro-5-fluoroanilino)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Nc2cc(F)c(Cl)cc2N)cc1C#N |
| InChI | InChI=1S/C14H8ClFN4/c15-11-4-13(19)14(5-12(11)16)20-10-2-1-8(6-17)9(3-10)7-18/h1-5,20H,19H2 |
| InChIKey | FHOADQKVKXGDOS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|