C12H12BrN3 — CID 107633766
4-N-(3-bromo-2-methylphenyl)pyridine-3,4-diamine (PubChem CID 107633766) has the molecular formula C12H12BrN3 and a molecular weight of 278.15 g/mol. Its IUPAC name is 4-N-(3-bromo-2-methylphenyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(3-bromo-2-methylphenyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 107633766 |
| Molecular Formula | C12H12BrN3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 4-N-(3-bromo-2-methylphenyl)pyridine-3,4-diamine |
| SMILES | Cc1c(Br)cccc1Nc1ccncc1N |
| InChI | InChI=1S/C12H12BrN3/c1-8-9(13)3-2-4-11(8)16-12-5-6-15-7-10(12)14/h2-7H,14H2,1H3,(H,15,16) |
| InChIKey | QVYLKGQZXFZRNX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |