C7H7Br2N — CID 155755469
N,3-dibromo-2-methylaniline (PubChem CID 155755469) has the molecular formula C7H7Br2N and a molecular weight of 264.95 g/mol. Its IUPAC name is N,3-dibromo-2-methylaniline.
| Compound Name | N,3-dibromo-2-methylaniline |
|---|---|
| PubChem CID | 155755469 |
| Molecular Formula | C7H7Br2N |
| Molecular Weight | 264.95 g/mol |
| Exact Mass | 262.89 |
| IUPAC Name | N,3-dibromo-2-methylaniline |
| SMILES | Cc1c(Br)cccc1NBr |
| InChI | InChI=1S/C7H7Br2N/c1-5-6(8)3-2-4-7(5)10-9/h2-4,10H,1H3 |
| InChIKey | KSAVAQAUIZLJKJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.95 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|