C16H17NO2 — CID 82088714
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dimethylaniline (PubChem CID 82088714) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dimethylaniline.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dimethylaniline |
|---|---|
| PubChem CID | 82088714 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,3-dimethylaniline |
| SMILES | Cc1cc(-c2ccc3c(c2)OCCO3)cc(N)c1C |
| InChI | InChI=1S/C16H17NO2/c1-10-7-13(8-14(17)11(10)2)12-3-4-15-16(9-12)19-6-5-18-15/h3-4,7-9H,5-6,17H2,1-2H3 |
| InChIKey | MFLQSFIKIWZSID-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|