C17H16O2 — CID 172650802
6-(3-ethenyl-5-methylphenyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 172650802) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 6-(3-ethenyl-5-methylphenyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(3-ethenyl-5-methylphenyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 172650802 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 6-(3-ethenyl-5-methylphenyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | C=Cc1cc(C)cc(-c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C17H16O2/c1-3-13-8-12(2)9-15(10-13)14-4-5-16-17(11-14)19-7-6-18-16/h3-5,8-11H,1,6-7H2,2H3 |
| InChIKey | DQWJIABOAYJOIA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |