C26H22N2O2 — CID 18874646
4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,6-bis(4-methylphenyl)pyridazine (PubChem CID 18874646) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,6-bis(4-methylphenyl)pyridazine.
| Compound Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,6-bis(4-methylphenyl)pyridazine |
|---|---|
| PubChem CID | 18874646 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,6-bis(4-methylphenyl)pyridazine |
| SMILES | Cc1ccc(-c2cc(-c3ccc4c(c3)OCCO4)c(-c3ccc(C)cc3)nn2)cc1 |
| InChI | InChI=1S/C26H22N2O2/c1-17-3-7-19(8-4-17)23-16-22(21-11-12-24-25(15-21)30-14-13-29-24)26(28-27-23)20-9-5-18(2)6-10-20/h3-12,15-16H,13-14H2,1-2H3 |
| InChIKey | KHKYOWJNPHNKIQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |