C16H15ClO2 — CID 61086135
6-[chloro-(4-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 61086135) has the molecular formula C16H15ClO2 and a molecular weight of 274.75 g/mol. Its IUPAC name is 6-[chloro-(4-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[chloro-(4-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 61086135 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 6-[chloro-(4-methylphenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1ccc(C(Cl)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C16H15ClO2/c1-11-2-4-12(5-3-11)16(17)13-6-7-14-15(10-13)19-9-8-18-14/h2-7,10,16H,8-9H2,1H3 |
| InChIKey | BUFGCCDHPKPMIX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|