C11H13ClO2 — CID 61083741
6-(1-chloropropyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 61083741) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is 6-(1-chloropropyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(1-chloropropyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 61083741 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 6-(1-chloropropyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCC(Cl)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H13ClO2/c1-2-9(12)8-3-4-10-11(7-8)14-6-5-13-10/h3-4,7,9H,2,5-6H2,1H3 |
| InChIKey | AXVGFQZFGDHICS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|