C12H15ClO2 — CID 82081024
6-(1-chlorobutan-2-yl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 82081024) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 6-(1-chlorobutan-2-yl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(1-chlorobutan-2-yl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 82081024 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 6-(1-chlorobutan-2-yl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCC(CCl)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H15ClO2/c1-2-9(8-13)10-3-4-11-12(7-10)15-6-5-14-11/h3-4,7,9H,2,5-6,8H2,1H3 |
| InChIKey | UHBCPBUQSUGXTI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|