C16H22O2 — CID 83922168
6-[(Z)-oct-5-en-3-yl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 83922168) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 6-[(Z)-oct-5-en-3-yl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[(Z)-oct-5-en-3-yl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 83922168 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 6-[(Z)-oct-5-en-3-yl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC/C=C\CC(CC)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H22O2/c1-3-5-6-7-13(4-2)14-8-9-15-16(12-14)18-11-10-17-15/h5-6,8-9,12-13H,3-4,7,10-11H2,1-2H3/b6-5- |
| InChIKey | UASHYOXDQIGXMS-WAYWQWQTSA-N |
| XLogP | 4.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|