C15H15ClO3 — CID 79083570
6-[chloro-(5-ethylfuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 79083570) has the molecular formula C15H15ClO3 and a molecular weight of 278.73 g/mol. Its IUPAC name is 6-[chloro-(5-ethylfuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[chloro-(5-ethylfuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 79083570 |
| Molecular Formula | C15H15ClO3 |
| Molecular Weight | 278.73 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 6-[chloro-(5-ethylfuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCc1ccc(C(Cl)c2ccc3c(c2)OCCO3)o1 |
| InChI | InChI=1S/C15H15ClO3/c1-2-11-4-6-13(19-11)15(16)10-3-5-12-14(9-10)18-8-7-17-12/h3-6,9,15H,2,7-8H2,1H3 |
| InChIKey | NWEDKJMKSOLDPD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.73 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|