C15H14BrClO3 — CID 79084025
6-bromo-7-[chloro-(5-ethylfuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 79084025) has the molecular formula C15H14BrClO3 and a molecular weight of 357.63 g/mol. Its IUPAC name is 6-bromo-7-[chloro-(5-ethylfuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-bromo-7-[chloro-(5-ethylfuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 79084025 |
| Molecular Formula | C15H14BrClO3 |
| Molecular Weight | 357.63 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 6-bromo-7-[chloro-(5-ethylfuran-2-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCc1ccc(C(Cl)c2cc3c(cc2Br)OCCO3)o1 |
| InChI | InChI=1S/C15H14BrClO3/c1-2-9-3-4-12(20-9)15(17)10-7-13-14(8-11(10)16)19-6-5-18-13/h3-4,7-8,15H,2,5-6H2,1H3 |
| InChIKey | VGKYPPGFYCLYGE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|