C13H9Br2ClO2S — CID 55198333
6-bromo-7-[(5-bromothiophen-2-yl)-chloromethyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 55198333) has the molecular formula C13H9Br2ClO2S and a molecular weight of 424.54 g/mol. Its IUPAC name is 6-bromo-7-[(5-bromothiophen-2-yl)-chloromethyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-bromo-7-[(5-bromothiophen-2-yl)-chloromethyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 55198333 |
| Molecular Formula | C13H9Br2ClO2S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 421.84 |
| IUPAC Name | 6-bromo-7-[(5-bromothiophen-2-yl)-chloromethyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | ClC(c1ccc(Br)s1)c1cc2c(cc1Br)OCCO2 |
| InChI | InChI=1S/C13H9Br2ClO2S/c14-8-6-10-9(17-3-4-18-10)5-7(8)13(16)11-1-2-12(15)19-11/h1-2,5-6,13H,3-4H2 |
| InChIKey | LZQPONVJCJGVGL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|