C15H14BrClO2S — CID 79808947
7-bromo-8-[chloro-(4-methylthiophen-3-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 79808947) has the molecular formula C15H14BrClO2S and a molecular weight of 373.70 g/mol. Its IUPAC name is 7-bromo-8-[chloro-(4-methylthiophen-3-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-bromo-8-[chloro-(4-methylthiophen-3-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 79808947 |
| Molecular Formula | C15H14BrClO2S |
| Molecular Weight | 373.70 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 7-bromo-8-[chloro-(4-methylthiophen-3-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | Cc1cscc1C(Cl)c1cc2c(cc1Br)OCCCO2 |
| InChI | InChI=1S/C15H14BrClO2S/c1-9-7-20-8-11(9)15(17)10-5-13-14(6-12(10)16)19-4-2-3-18-13/h5-8,15H,2-4H2,1H3 |
| InChIKey | ZFNCWDWMRUVEDN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.70 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|