C15H13BrO2 — CID 138488049
6-(2-bromo-3-methylphenyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 138488049) has the molecular formula C15H13BrO2 and a molecular weight of 305.17 g/mol. Its IUPAC name is 6-(2-bromo-3-methylphenyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-(2-bromo-3-methylphenyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 138488049 |
| Molecular Formula | C15H13BrO2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 6-(2-bromo-3-methylphenyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1cccc(-c2ccc3c(c2)OCCO3)c1Br |
| InChI | InChI=1S/C15H13BrO2/c1-10-3-2-4-12(15(10)16)11-5-6-13-14(9-11)18-8-7-17-13/h2-6,9H,7-8H2,1H3 |
| InChIKey | XNZXKFQZLMEWSQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |