C20H22O2S — CID 145435778
2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethynyl-trimethyl-λ4-sulfane (PubChem CID 145435778) has the molecular formula C20H22O2S and a molecular weight of 326.46 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethynyl-trimethyl-λ4-sulfane.
| Compound Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethynyl-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 145435778 |
| Molecular Formula | C20H22O2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethynyl-trimethyl-λ4-sulfane |
| SMILES | Cc1c(C#CS(C)(C)C)cccc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H22O2S/c1-15-16(10-13-23(2,3)4)6-5-7-18(15)17-8-9-19-20(14-17)22-12-11-21-19/h5-9,14H,11-12H2,1-4H3 |
| InChIKey | KQPJEFVVOZVGOU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|