C25H27NO4 — CID 164620446
2-[[4-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-2-methoxyphenyl]methylamino]ethanol (PubChem CID 164620446) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 2-[[4-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-2-methoxyphenyl]methylamino]ethanol.
| Compound Name | 2-[[4-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-2-methoxyphenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 164620446 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[[4-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-2-methoxyphenyl]methylamino]ethanol |
| SMILES | COc1cc(-c2cccc(-c3ccc4c(c3)OCCO4)c2C)ccc1CNCCO |
| InChI | InChI=1S/C25H27NO4/c1-17-21(18-6-7-20(16-26-10-11-27)24(14-18)28-2)4-3-5-22(17)19-8-9-23-25(15-19)30-13-12-29-23/h3-9,14-15,26-27H,10-13,16H2,1-2H3 |
| InChIKey | NIWQEBJMHBRIOF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|