C27H27F2NO5 — CID 130316789
4-[[4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2,5-difluorophenyl]methylamino]butanoic acid (PubChem CID 130316789) has the molecular formula C27H27F2NO5 and a molecular weight of 483.51 g/mol. Its IUPAC name is 4-[[4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2,5-difluorophenyl]methylamino]butanoic acid.
| Compound Name | 4-[[4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2,5-difluorophenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 130316789 |
| Molecular Formula | C27H27F2NO5 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 4-[[4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2,5-difluorophenyl]methylamino]butanoic acid |
| SMILES | Cc1c(COc2cc(F)c(CNCCCC(=O)O)cc2F)cccc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C27H27F2NO5/c1-17-19(4-2-5-21(17)18-7-8-24-26(13-18)34-11-10-33-24)16-35-25-14-22(28)20(12-23(25)29)15-30-9-3-6-27(31)32/h2,4-5,7-8,12-14,30H,3,6,9-11,15-16H2,1H3,(H,31,32) |
| InChIKey | MKQSUGUVXQELCZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|