C23H19ClO5 — CID 118434771
3-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-hydroxybenzaldehyde (PubChem CID 118434771) has the molecular formula C23H19ClO5 and a molecular weight of 410.85 g/mol. Its IUPAC name is 3-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-hydroxybenzaldehyde.
| Compound Name | 3-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 118434771 |
| Molecular Formula | C23H19ClO5 |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 3-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-hydroxybenzaldehyde |
| SMILES | Cc1c(COc2ccc(C=O)c(O)c2Cl)cccc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H19ClO5/c1-14-17(13-29-20-8-6-16(12-25)23(26)22(20)24)3-2-4-18(14)15-5-7-19-21(11-15)28-10-9-27-19/h2-8,11-12,26H,9-10,13H2,1H3 |
| InChIKey | LJIBOFMMNPROGR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|