C24H21ClO5 — CID 155375209
5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-methoxybenzaldehyde (PubChem CID 155375209) has the molecular formula C24H21ClO5 and a molecular weight of 424.88 g/mol. Its IUPAC name is 5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-methoxybenzaldehyde.
| Compound Name | 5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 155375209 |
| Molecular Formula | C24H21ClO5 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-methoxybenzaldehyde |
| SMILES | COc1cc(OCc2cccc(-c3ccc4c(c3)OCCO4)c2C)c(Cl)cc1C=O |
| InChI | InChI=1S/C24H21ClO5/c1-15-17(14-30-23-12-22(27-2)18(13-26)10-20(23)25)4-3-5-19(15)16-6-7-21-24(11-16)29-9-8-28-21/h3-7,10-13H,8-9,14H2,1-2H3 |
| InChIKey | RZFJCBHKOPOPRT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|