C33H37ClF3NO6 — CID 166471396
1-[[5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-(4,4,4-trifluorobutoxy)phenyl]methyl]piperidine;formic acid (PubChem CID 166471396) has the molecular formula C33H37ClF3NO6 and a molecular weight of 636.11 g/mol. Its IUPAC name is 1-[[5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-(4,4,4-trifluorobutoxy)phenyl]methyl]piperidine;formic acid.
| Compound Name | 1-[[5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-(4,4,4-trifluorobutoxy)phenyl]methyl]piperidine;formic acid |
|---|---|
| PubChem CID | 166471396 |
| Molecular Formula | C33H37ClF3NO6 |
| Molecular Weight | 636.11 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | 1-[[5-chloro-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-(4,4,4-trifluorobutoxy)phenyl]methyl]piperidine;formic acid |
| SMILES | Cc1c(COc2cc(OCCCC(F)(F)F)c(CN3CCCCC3)cc2Cl)cccc1-c1ccc2c(c1)OCCO2.O=CO |
| InChI | InChI=1S/C32H35ClF3NO4.CH2O2/c1-22-24(7-5-8-26(22)23-9-10-28-31(18-23)40-16-15-39-28)21-41-30-19-29(38-14-6-11-32(34,35)36)25(17-27(30)33)20-37-12-3-2-4-13-37;2-1-3/h5,7-10,17-19H,2-4,6,11-16,20-21H2,1H3;1H,(H,2,3) |
| InChIKey | XTHAXWIANQKAEP-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.11 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|