C27H30ClNO3 — CID 144804078
1-[[3-chloro-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine;formic acid (PubChem CID 144804078) has the molecular formula C27H30ClNO3 and a molecular weight of 451.99 g/mol. Its IUPAC name is 1-[[3-chloro-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine;formic acid.
| Compound Name | 1-[[3-chloro-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine;formic acid |
|---|---|
| PubChem CID | 144804078 |
| Molecular Formula | C27H30ClNO3 |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 1-[[3-chloro-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine;formic acid |
| SMILES | Cc1c(COc2ccc(CN3CCCCC3)cc2Cl)cccc1-c1ccccc1.O=CO |
| InChI | InChI=1S/C26H28ClNO.CH2O2/c1-20-23(11-8-12-24(20)22-9-4-2-5-10-22)19-29-26-14-13-21(17-25(26)27)18-28-15-6-3-7-16-28;2-1-3/h2,4-5,8-14,17H,3,6-7,15-16,18-19H2,1H3;1H,(H,2,3) |
| InChIKey | ZRJFNUPWVSIRFG-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|