C28H22ClNO4 — CID 175495724
5-[[4-chloro-2-formyl-5-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]pyridine-3-carboxylic acid (PubChem CID 175495724) has the molecular formula C28H22ClNO4 and a molecular weight of 471.94 g/mol. Its IUPAC name is 5-[[4-chloro-2-formyl-5-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]pyridine-3-carboxylic acid.
| Compound Name | 5-[[4-chloro-2-formyl-5-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175495724 |
| Molecular Formula | C28H22ClNO4 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 5-[[4-chloro-2-formyl-5-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]pyridine-3-carboxylic acid |
| SMILES | Cc1c(COc2cc(Cc3cncc(C(=O)O)c3)c(C=O)cc2Cl)cccc1-c1ccccc1 |
| InChI | InChI=1S/C28H22ClNO4/c1-18-21(8-5-9-25(18)20-6-3-2-4-7-20)17-34-27-13-22(24(16-31)12-26(27)29)10-19-11-23(28(32)33)15-30-14-19/h2-9,11-16H,10,17H2,1H3,(H,32,33) |
| InChIKey | UABPFZFMISULAT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|