C29H31FN2O7 — CID 172802192
6-[[4-[[3-(2,3-dihydroxy-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-fluorophenyl]methylamino]-N-hydroxyhexanamide (PubChem CID 172802192) has the molecular formula C29H31FN2O7 and a molecular weight of 538.57 g/mol. Its IUPAC name is 6-[[4-[[3-(2,3-dihydroxy-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-fluorophenyl]methylamino]-N-hydroxyhexanamide.
| Compound Name | 6-[[4-[[3-(2,3-dihydroxy-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-fluorophenyl]methylamino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 172802192 |
| Molecular Formula | C29H31FN2O7 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 6-[[4-[[3-(2,3-dihydroxy-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-2-fluorophenyl]methylamino]-N-hydroxyhexanamide |
| SMILES | Cc1c(COc2ccc(CNCCCCCC(=O)NO)c(F)c2)cccc1-c1ccc2c(c1)OC(O)=C(O)O2 |
| InChI | InChI=1S/C29H31FN2O7/c1-18-21(6-5-7-23(18)19-10-12-25-26(14-19)39-29(35)28(34)38-25)17-37-22-11-9-20(24(30)15-22)16-31-13-4-2-3-8-27(33)32-36/h5-7,9-12,14-15,31,34-36H,2-4,8,13,16-17H2,1H3,(H,32,33) |
| InChIKey | QZYWIFCFSOZMBY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 129.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|