C34H36FNO4 — CID 159681435
N-[4-[2-[(4-fluoro-3-methoxyphenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]butyl]acetamide (PubChem CID 159681435) has the molecular formula C34H36FNO4 and a molecular weight of 541.66 g/mol. Its IUPAC name is N-[4-[2-[(4-fluoro-3-methoxyphenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]butyl]acetamide.
| Compound Name | N-[4-[2-[(4-fluoro-3-methoxyphenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]butyl]acetamide |
|---|---|
| PubChem CID | 159681435 |
| Molecular Formula | C34H36FNO4 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | N-[4-[2-[(4-fluoro-3-methoxyphenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]butyl]acetamide |
| SMILES | COc1cc(COc2cc(OCc3cccc(-c4ccccc4)c3C)ccc2CCCCNC(C)=O)ccc1F |
| InChI | InChI=1S/C34H36FNO4/c1-24-29(13-9-14-31(24)27-10-5-4-6-11-27)23-39-30-17-16-28(12-7-8-19-36-25(2)37)33(21-30)40-22-26-15-18-32(35)34(20-26)38-3/h4-6,9-11,13-18,20-21H,7-8,12,19,22-23H2,1-3H3,(H,36,37) |
| InChIKey | MVGCJWOIYJLIRS-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|