C30H36N2O5 — CID 118434905
methyl 4-[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]butanoate (PubChem CID 118434905) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is methyl 4-[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]butanoate.
| Compound Name | methyl 4-[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]butanoate |
|---|---|
| PubChem CID | 118434905 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | methyl 4-[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1cc(OCc2cccc(-c3ccccc3)c2C)ccc1CNCCNC(C)=O |
| InChI | InChI=1S/C30H36N2O5/c1-22-26(11-7-12-28(22)24-9-5-4-6-10-24)21-37-27-15-14-25(20-31-16-17-32-23(2)33)29(19-27)36-18-8-13-30(34)35-3/h4-7,9-12,14-15,19,31H,8,13,16-18,20-21H2,1-3H3,(H,32,33) |
| InChIKey | ZAIZIBBKNSGNJX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|