C43H54N4O6 — CID 146240043
1-[2-[[2-[(3-cyanophenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]ethyl]-3-[(2S)-1-hydroxy-1,3-bis(2-methylpropoxy)propan-2-yl]urea (PubChem CID 146240043) has the molecular formula C43H54N4O6 and a molecular weight of 722.93 g/mol. Its IUPAC name is 1-[2-[[2-[(3-cyanophenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]ethyl]-3-[(2S)-1-hydroxy-1,3-bis(2-methylpropoxy)propan-2-yl]urea.
| Compound Name | 1-[2-[[2-[(3-cyanophenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]ethyl]-3-[(2S)-1-hydroxy-1,3-bis(2-methylpropoxy)propan-2-yl]urea |
|---|---|
| PubChem CID | 146240043 |
| Molecular Formula | C43H54N4O6 |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 722.40 |
| IUPAC Name | 1-[2-[[2-[(3-cyanophenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]ethyl]-3-[(2S)-1-hydroxy-1,3-bis(2-methylpropoxy)propan-2-yl]urea |
| SMILES | Cc1c(COc2ccc(CNCCNC(=O)N[C@@H](COCC(C)C)C(O)OCC(C)C)c(OCc3cccc(C#N)c3)c2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C43H54N4O6/c1-30(2)25-50-29-40(42(48)53-26-31(3)4)47-43(49)46-20-19-45-24-36-17-18-38(22-41(36)52-27-34-12-9-11-33(21-34)23-44)51-28-37-15-10-16-39(32(37)5)35-13-7-6-8-14-35/h6-18,21-22,30-31,40,42,45,48H,19-20,24-29H2,1-5H3,(H2,46,47,49)/t40-,42?/m0/s1 |
| InChIKey | YUOHTCPJDJAFQH-UJGAEZNTSA-N |
| XLogP | 7.11 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|