C30H26ClFN2O3 — CID 163212059
3-[[5-[[2-chloro-3-(2-fluorophenyl)phenyl]methoxy]-2-[(2-hydroxyethylamino)methyl]phenoxy]methyl]benzonitrile (PubChem CID 163212059) has the molecular formula C30H26ClFN2O3 and a molecular weight of 517.00 g/mol. Its IUPAC name is 3-[[5-[[2-chloro-3-(2-fluorophenyl)phenyl]methoxy]-2-[(2-hydroxyethylamino)methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 3-[[5-[[2-chloro-3-(2-fluorophenyl)phenyl]methoxy]-2-[(2-hydroxyethylamino)methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 163212059 |
| Molecular Formula | C30H26ClFN2O3 |
| Molecular Weight | 517.00 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 3-[[5-[[2-chloro-3-(2-fluorophenyl)phenyl]methoxy]-2-[(2-hydroxyethylamino)methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1cccc(COc2cc(OCc3cccc(-c4ccccc4F)c3Cl)ccc2CNCCO)c1 |
| InChI | InChI=1S/C30H26ClFN2O3/c31-30-24(7-4-9-27(30)26-8-1-2-10-28(26)32)20-36-25-12-11-23(18-34-13-14-35)29(16-25)37-19-22-6-3-5-21(15-22)17-33/h1-12,15-16,34-35H,13-14,18-20H2 |
| InChIKey | MWHIDSZICJNFIK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 74.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.00 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|