C37H40N2O4 — CID 175168684
methyl 7-[[2-[(3-cyanophenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]heptanoate (PubChem CID 175168684) has the molecular formula C37H40N2O4 and a molecular weight of 576.74 g/mol. Its IUPAC name is methyl 7-[[2-[(3-cyanophenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]heptanoate.
| Compound Name | methyl 7-[[2-[(3-cyanophenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]heptanoate |
|---|---|
| PubChem CID | 175168684 |
| Molecular Formula | C37H40N2O4 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | methyl 7-[[2-[(3-cyanophenyl)methoxy]-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methylamino]heptanoate |
| SMILES | COC(=O)CCCCCCNCc1ccc(OCc2cccc(-c3ccccc3)c2C)cc1OCc1cccc(C#N)c1 |
| InChI | InChI=1S/C37H40N2O4/c1-28-33(16-11-17-35(28)31-14-6-5-7-15-31)27-42-34-20-19-32(25-39-21-9-4-3-8-18-37(40)41-2)36(23-34)43-26-30-13-10-12-29(22-30)24-38/h5-7,10-17,19-20,22-23,39H,3-4,8-9,18,21,25-27H2,1-2H3 |
| InChIKey | DDKKKCKBEWZSIN-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|