C35H38N2O5 — CID 135369295
2-[3-[[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]methyl]phenyl]propanoic acid (PubChem CID 135369295) has the molecular formula C35H38N2O5 and a molecular weight of 566.70 g/mol. Its IUPAC name is 2-[3-[[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]methyl]phenyl]propanoic acid.
| Compound Name | 2-[3-[[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135369295 |
| Molecular Formula | C35H38N2O5 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | 2-[3-[[2-[(2-acetamidoethylamino)methyl]-5-[(2-methyl-3-phenylphenyl)methoxy]phenoxy]methyl]phenyl]propanoic acid |
| SMILES | CC(=O)NCCNCc1ccc(OCc2cccc(-c3ccccc3)c2C)cc1OCc1cccc(C(C)C(=O)O)c1 |
| InChI | InChI=1S/C35H38N2O5/c1-24-31(13-8-14-33(24)28-10-5-4-6-11-28)23-41-32-16-15-30(21-36-17-18-37-26(3)38)34(20-32)42-22-27-9-7-12-29(19-27)25(2)35(39)40/h4-16,19-20,25,36H,17-18,21-23H2,1-3H3,(H,37,38)(H,39,40) |
| InChIKey | AWKCMSUWDHEYES-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|