C29H22N2O3 — CID 161048194
3-[[5-formyl-2-[2-(2-methyl-3-phenylphenyl)acetyl]-4-pyridinyl]oxymethyl]benzonitrile (PubChem CID 161048194) has the molecular formula C29H22N2O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 3-[[5-formyl-2-[2-(2-methyl-3-phenylphenyl)acetyl]-4-pyridinyl]oxymethyl]benzonitrile.
| Compound Name | 3-[[5-formyl-2-[2-(2-methyl-3-phenylphenyl)acetyl]-4-pyridinyl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 161048194 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 3-[[5-formyl-2-[2-(2-methyl-3-phenylphenyl)acetyl]-4-pyridinyl]oxymethyl]benzonitrile |
| SMILES | Cc1c(CC(=O)c2cc(OCc3cccc(C#N)c3)c(C=O)cn2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C29H22N2O3/c1-20-24(11-6-12-26(20)23-9-3-2-4-10-23)14-28(33)27-15-29(25(18-32)17-31-27)34-19-22-8-5-7-21(13-22)16-30/h2-13,15,17-18H,14,19H2,1H3 |
| InChIKey | UBTXBKMVZBXEPT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|