C28H19BrClNO3 — CID 138488047
3-[[5-[(2-bromo-3-phenylphenyl)methoxy]-4-chloro-2-formylphenoxy]methyl]benzonitrile (PubChem CID 138488047) has the molecular formula C28H19BrClNO3 and a molecular weight of 532.82 g/mol. Its IUPAC name is 3-[[5-[(2-bromo-3-phenylphenyl)methoxy]-4-chloro-2-formylphenoxy]methyl]benzonitrile.
| Compound Name | 3-[[5-[(2-bromo-3-phenylphenyl)methoxy]-4-chloro-2-formylphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 138488047 |
| Molecular Formula | C28H19BrClNO3 |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | 3-[[5-[(2-bromo-3-phenylphenyl)methoxy]-4-chloro-2-formylphenoxy]methyl]benzonitrile |
| SMILES | N#Cc1cccc(COc2cc(OCc3cccc(-c4ccccc4)c3Br)c(Cl)cc2C=O)c1 |
| InChI | InChI=1S/C28H19BrClNO3/c29-28-22(10-5-11-24(28)21-8-2-1-3-9-21)18-34-27-14-26(23(16-32)13-25(27)30)33-17-20-7-4-6-19(12-20)15-31/h1-14,16H,17-18H2 |
| InChIKey | KUBOISXZFWLUSD-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|