C37H37ClN2O5 — CID 129019745
3-[[4-chloro-2-formyl-5-[[2-methyl-3-[2-methyl-3-(3-morpholin-4-ylpropoxy)phenyl]phenyl]methoxy]phenoxy]methyl]benzonitrile (PubChem CID 129019745) has the molecular formula C37H37ClN2O5 and a molecular weight of 625.17 g/mol. Its IUPAC name is 3-[[4-chloro-2-formyl-5-[[2-methyl-3-[2-methyl-3-(3-morpholin-4-ylpropoxy)phenyl]phenyl]methoxy]phenoxy]methyl]benzonitrile.
| Compound Name | 3-[[4-chloro-2-formyl-5-[[2-methyl-3-[2-methyl-3-(3-morpholin-4-ylpropoxy)phenyl]phenyl]methoxy]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 129019745 |
| Molecular Formula | C37H37ClN2O5 |
| Molecular Weight | 625.17 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 3-[[4-chloro-2-formyl-5-[[2-methyl-3-[2-methyl-3-(3-morpholin-4-ylpropoxy)phenyl]phenyl]methoxy]phenoxy]methyl]benzonitrile |
| SMILES | Cc1c(COc2cc(OCc3cccc(C#N)c3)c(C=O)cc2Cl)cccc1-c1cccc(OCCCN2CCOCC2)c1C |
| InChI | InChI=1S/C37H37ClN2O5/c1-26-30(25-45-37-21-36(31(23-41)20-34(37)38)44-24-29-8-3-7-28(19-29)22-39)9-4-10-32(26)33-11-5-12-35(27(33)2)43-16-6-13-40-14-17-42-18-15-40/h3-5,7-12,19-21,23H,6,13-18,24-25H2,1-2H3 |
| InChIKey | SMHMAVSRCOBHML-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.17 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|