C43H38ClN3O5 — CID 129019586
5-[[4-chloro-2-formyl-5-[[3-[3-[3-(3-hydroxypyrrolidin-1-yl)propoxy]-5-(2-phenylethynyl)phenyl]-2-methylphenyl]methoxy]phenoxy]methyl]pyridine-3-carbonitrile (PubChem CID 129019586) has the molecular formula C43H38ClN3O5 and a molecular weight of 712.25 g/mol. Its IUPAC name is 5-[[4-chloro-2-formyl-5-[[3-[3-[3-(3-hydroxypyrrolidin-1-yl)propoxy]-5-(2-phenylethynyl)phenyl]-2-methylphenyl]methoxy]phenoxy]methyl]pyridine-3-carbonitrile.
| Compound Name | 5-[[4-chloro-2-formyl-5-[[3-[3-[3-(3-hydroxypyrrolidin-1-yl)propoxy]-5-(2-phenylethynyl)phenyl]-2-methylphenyl]methoxy]phenoxy]methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 129019586 |
| Molecular Formula | C43H38ClN3O5 |
| Molecular Weight | 712.25 g/mol |
| Exact Mass | 711.25 |
| IUPAC Name | 5-[[4-chloro-2-formyl-5-[[3-[3-[3-(3-hydroxypyrrolidin-1-yl)propoxy]-5-(2-phenylethynyl)phenyl]-2-methylphenyl]methoxy]phenoxy]methyl]pyridine-3-carbonitrile |
| SMILES | Cc1c(COc2cc(OCc3cncc(C#N)c3)c(C=O)cc2Cl)cccc1-c1cc(C#Cc2ccccc2)cc(OCCCN2CCC(O)C2)c1 |
| InChI | InChI=1S/C43H38ClN3O5/c1-30-35(29-52-43-22-42(37(27-48)21-41(43)44)51-28-34-17-33(23-45)24-46-25-34)9-5-10-40(30)36-18-32(12-11-31-7-3-2-4-8-31)19-39(20-36)50-16-6-14-47-15-13-38(49)26-47/h2-5,7-10,17-22,24-25,27,38,49H,6,13-16,26,28-29H2,1H3 |
| InChIKey | VUQNAYLYNPJDDJ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.25 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|