C35H36Cl2N2O7S — CID 129020613
5-chloro-4-[[3-[2-chloro-3-[3-(3-hydroxypyrrolidin-1-yl)propoxy]phenyl]-2-methylphenyl]methoxy]-2-[(5-methylsulfonyl-3-pyridinyl)methoxy]benzaldehyde (PubChem CID 129020613) has the molecular formula C35H36Cl2N2O7S and a molecular weight of 699.65 g/mol. Its IUPAC name is 5-chloro-4-[[3-[2-chloro-3-[3-(3-hydroxypyrrolidin-1-yl)propoxy]phenyl]-2-methylphenyl]methoxy]-2-[(5-methylsulfonyl-3-pyridinyl)methoxy]benzaldehyde.
| Compound Name | 5-chloro-4-[[3-[2-chloro-3-[3-(3-hydroxypyrrolidin-1-yl)propoxy]phenyl]-2-methylphenyl]methoxy]-2-[(5-methylsulfonyl-3-pyridinyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 129020613 |
| Molecular Formula | C35H36Cl2N2O7S |
| Molecular Weight | 699.65 g/mol |
| Exact Mass | 698.16 |
| IUPAC Name | 5-chloro-4-[[3-[2-chloro-3-[3-(3-hydroxypyrrolidin-1-yl)propoxy]phenyl]-2-methylphenyl]methoxy]-2-[(5-methylsulfonyl-3-pyridinyl)methoxy]benzaldehyde |
| SMILES | Cc1c(COc2cc(OCc3cncc(S(C)(=O)=O)c3)c(C=O)cc2Cl)cccc1-c1cccc(OCCCN2CCC(O)C2)c1Cl |
| InChI | InChI=1S/C35H36Cl2N2O7S/c1-23-25(6-3-7-29(23)30-8-4-9-32(35(30)37)44-13-5-11-39-12-10-27(41)19-39)22-46-34-16-33(26(20-40)15-31(34)36)45-21-24-14-28(18-38-17-24)47(2,42)43/h3-4,6-9,14-18,20,27,41H,5,10-13,19,21-22H2,1-2H3 |
| InChIKey | CMFMLFFWPSJLPK-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|