C34H37ClN2O4 — CID 139491373
7-[3-[3-[3-[(2-chloro-4-formyl-5-hydroxyphenoxy)methyl]-2-methylphenyl]-2-methylphenoxy]propyl]-7-azaspiro[3.5]nonane-2-carbonitrile (PubChem CID 139491373) has the molecular formula C34H37ClN2O4 and a molecular weight of 573.13 g/mol. Its IUPAC name is 7-[3-[3-[3-[(2-chloro-4-formyl-5-hydroxyphenoxy)methyl]-2-methylphenyl]-2-methylphenoxy]propyl]-7-azaspiro[3.5]nonane-2-carbonitrile.
| Compound Name | 7-[3-[3-[3-[(2-chloro-4-formyl-5-hydroxyphenoxy)methyl]-2-methylphenyl]-2-methylphenoxy]propyl]-7-azaspiro[3.5]nonane-2-carbonitrile |
|---|---|
| PubChem CID | 139491373 |
| Molecular Formula | C34H37ClN2O4 |
| Molecular Weight | 573.13 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 7-[3-[3-[3-[(2-chloro-4-formyl-5-hydroxyphenoxy)methyl]-2-methylphenyl]-2-methylphenoxy]propyl]-7-azaspiro[3.5]nonane-2-carbonitrile |
| SMILES | Cc1c(COc2cc(O)c(C=O)cc2Cl)cccc1-c1cccc(OCCCN2CCC3(CC2)CC(C#N)C3)c1C |
| InChI | InChI=1S/C34H37ClN2O4/c1-23-26(22-41-33-17-31(39)27(21-38)16-30(33)35)6-3-7-28(23)29-8-4-9-32(24(29)2)40-15-5-12-37-13-10-34(11-14-37)18-25(19-34)20-36/h3-4,6-9,16-17,21,25,39H,5,10-15,18-19,22H2,1-2H3 |
| InChIKey | RVSPGEGYLIODGP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.13 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|