C32H35ClN2O5 — CID 153342975
5-chloro-2-hydroxy-4-[[2-methyl-3-[2-methyl-3-[3-(2-oxo-1,7-diazaspiro[4.4]nonan-7-yl)propoxy]phenyl]phenyl]methoxy]benzaldehyde (PubChem CID 153342975) has the molecular formula C32H35ClN2O5 and a molecular weight of 563.09 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-4-[[2-methyl-3-[2-methyl-3-[3-(2-oxo-1,7-diazaspiro[4.4]nonan-7-yl)propoxy]phenyl]phenyl]methoxy]benzaldehyde.
| Compound Name | 5-chloro-2-hydroxy-4-[[2-methyl-3-[2-methyl-3-[3-(2-oxo-1,7-diazaspiro[4.4]nonan-7-yl)propoxy]phenyl]phenyl]methoxy]benzaldehyde |
|---|---|
| PubChem CID | 153342975 |
| Molecular Formula | C32H35ClN2O5 |
| Molecular Weight | 563.09 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 5-chloro-2-hydroxy-4-[[2-methyl-3-[2-methyl-3-[3-(2-oxo-1,7-diazaspiro[4.4]nonan-7-yl)propoxy]phenyl]phenyl]methoxy]benzaldehyde |
| SMILES | Cc1c(COc2cc(O)c(C=O)cc2Cl)cccc1-c1cccc(OCCCN2CCC3(CCC(=O)N3)C2)c1C |
| InChI | InChI=1S/C32H35ClN2O5/c1-21-23(19-40-30-17-28(37)24(18-36)16-27(30)33)6-3-7-25(21)26-8-4-9-29(22(26)2)39-15-5-13-35-14-12-32(20-35)11-10-31(38)34-32/h3-4,6-9,16-18,37H,5,10-15,19-20H2,1-2H3,(H,34,38) |
| InChIKey | KFMIHERANSHTJF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.09 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|