C32H28N2O6 — CID 175506932
[4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]-2-[(3-cyanophenyl)methoxy]phenyl] 2-methyl-3-phenylbenzoate (PubChem CID 175506932) has the molecular formula C32H28N2O6 and a molecular weight of 536.58 g/mol. Its IUPAC name is [4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]-2-[(3-cyanophenyl)methoxy]phenyl] 2-methyl-3-phenylbenzoate.
| Compound Name | [4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]-2-[(3-cyanophenyl)methoxy]phenyl] 2-methyl-3-phenylbenzoate |
|---|---|
| PubChem CID | 175506932 |
| Molecular Formula | C32H28N2O6 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | [4-[[(2S)-2-amino-3-hydroxypropanoyl]oxymethyl]-2-[(3-cyanophenyl)methoxy]phenyl] 2-methyl-3-phenylbenzoate |
| SMILES | Cc1c(C(=O)Oc2ccc(COC(=O)[C@@H](N)CO)cc2OCc2cccc(C#N)c2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C32H28N2O6/c1-21-26(25-9-3-2-4-10-25)11-6-12-27(21)31(36)40-29-14-13-24(20-39-32(37)28(34)18-35)16-30(29)38-19-23-8-5-7-22(15-23)17-33/h2-16,28,35H,18-20,34H2,1H3/t28-/m0/s1 |
| InChIKey | QCFZBLAQSKFZQK-NDEPHWFRSA-N |
| XLogP | 4.69 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|