C28H34N2O4 — CID 160722041
N-[4-[6-[[3-[3-(hydroxymethyl)-2-methylphenyl]-2-methylphenyl]methoxy]-2-methoxy-3-pyridinyl]butyl]acetamide (PubChem CID 160722041) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-[4-[6-[[3-[3-(hydroxymethyl)-2-methylphenyl]-2-methylphenyl]methoxy]-2-methoxy-3-pyridinyl]butyl]acetamide.
| Compound Name | N-[4-[6-[[3-[3-(hydroxymethyl)-2-methylphenyl]-2-methylphenyl]methoxy]-2-methoxy-3-pyridinyl]butyl]acetamide |
|---|---|
| PubChem CID | 160722041 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[4-[6-[[3-[3-(hydroxymethyl)-2-methylphenyl]-2-methylphenyl]methoxy]-2-methoxy-3-pyridinyl]butyl]acetamide |
| SMILES | COc1nc(OCc2cccc(-c3cccc(CO)c3C)c2C)ccc1CCCCNC(C)=O |
| InChI | InChI=1S/C28H34N2O4/c1-19-23(17-31)10-7-12-25(19)26-13-8-11-24(20(26)2)18-34-27-15-14-22(28(30-27)33-4)9-5-6-16-29-21(3)32/h7-8,10-15,31H,5-6,9,16-18H2,1-4H3,(H,29,32) |
| InChIKey | NOZCGVMFPGWXEC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|