C30H34N2O7 — CID 163912501
[[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methyl-(4-oxopentyl)carbamoyl]oxymethyl acetate (PubChem CID 163912501) has the molecular formula C30H34N2O7 and a molecular weight of 534.61 g/mol. Its IUPAC name is [[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methyl-(4-oxopentyl)carbamoyl]oxymethyl acetate.
| Compound Name | [[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methyl-(4-oxopentyl)carbamoyl]oxymethyl acetate |
|---|---|
| PubChem CID | 163912501 |
| Molecular Formula | C30H34N2O7 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | [[2-methoxy-6-[(2-methyl-3-phenylphenyl)methoxy]-3-pyridinyl]methyl-(4-oxopentyl)carbamoyl]oxymethyl acetate |
| SMILES | COc1nc(OCc2cccc(-c3ccccc3)c2C)ccc1CN(CCCC(C)=O)C(=O)OCOC(C)=O |
| InChI | InChI=1S/C30H34N2O7/c1-21(33)10-9-17-32(30(35)39-20-38-23(3)34)18-25-15-16-28(31-29(25)36-4)37-19-26-13-8-14-27(22(26)2)24-11-6-5-7-12-24/h5-8,11-16H,9-10,17-20H2,1-4H3 |
| InChIKey | QTJFEBYELXKWHF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|