C33H37NO4 — CID 138555285
2-[[2-(cyclohexylmethoxy)-4-[2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethynyl]phenyl]methylamino]ethanol (PubChem CID 138555285) has the molecular formula C33H37NO4 and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-[[2-(cyclohexylmethoxy)-4-[2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethynyl]phenyl]methylamino]ethanol.
| Compound Name | 2-[[2-(cyclohexylmethoxy)-4-[2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethynyl]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 138555285 |
| Molecular Formula | C33H37NO4 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | 2-[[2-(cyclohexylmethoxy)-4-[2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethynyl]phenyl]methylamino]ethanol |
| SMILES | Cc1c(C#Cc2ccc(CNCCO)c(OCC3CCCCC3)c2)cccc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C33H37NO4/c1-24-27(8-5-9-30(24)28-14-15-31-33(21-28)37-19-18-36-31)12-10-25-11-13-29(22-34-16-17-35)32(20-25)38-23-26-6-3-2-4-7-26/h5,8-9,11,13-15,20-21,26,34-35H,2-4,6-7,16-19,22-23H2,1H3 |
| InChIKey | HYQBTSNENHTMEI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|