C25H26N2O3 — CID 138606892
2-[[6-[(E)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethenyl]-3-pyridinyl]methylamino]ethanol (PubChem CID 138606892) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[[6-[(E)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethenyl]-3-pyridinyl]methylamino]ethanol.
| Compound Name | 2-[[6-[(E)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethenyl]-3-pyridinyl]methylamino]ethanol |
|---|---|
| PubChem CID | 138606892 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[[6-[(E)-2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]ethenyl]-3-pyridinyl]methylamino]ethanol |
| SMILES | Cc1c(/C=C/c2ccc(CNCCO)cn2)cccc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H26N2O3/c1-18-20(6-9-22-8-5-19(17-27-22)16-26-11-12-28)3-2-4-23(18)21-7-10-24-25(15-21)30-14-13-29-24/h2-10,15,17,26,28H,11-14,16H2,1H3/b9-6+ |
| InChIKey | MHFUDVPFYCJRCC-RMKNXTFCSA-N |
| XLogP | 4.08 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|