C26H26N2O4 — CID 164628918
2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-5-[(2-hydroxyethylamino)methyl]-3H-isoindol-1-one (PubChem CID 164628918) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-5-[(2-hydroxyethylamino)methyl]-3H-isoindol-1-one.
| Compound Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-5-[(2-hydroxyethylamino)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 164628918 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]-5-[(2-hydroxyethylamino)methyl]-3H-isoindol-1-one |
| SMILES | Cc1c(-c2ccc3c(c2)OCCO3)cccc1N1Cc2cc(CNCCO)ccc2C1=O |
| InChI | InChI=1S/C26H26N2O4/c1-17-21(19-6-8-24-25(14-19)32-12-11-31-24)3-2-4-23(17)28-16-20-13-18(15-27-9-10-29)5-7-22(20)26(28)30/h2-8,13-14,27,29H,9-12,15-16H2,1H3 |
| InChIKey | XEOZTRCGSMCBCI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|