C16H13NO2 — CID 164566293
7-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-indole (PubChem CID 164566293) has the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. Its IUPAC name is 7-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-indole.
| Compound Name | 7-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-indole |
|---|---|
| PubChem CID | 164566293 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 7-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-indole |
| SMILES | c1cc(-c2ccc3c(c2)OCCO3)c2[nH]ccc2c1 |
| InChI | InChI=1S/C16H13NO2/c1-2-11-6-7-17-16(11)13(3-1)12-4-5-14-15(10-12)19-9-8-18-14/h1-7,10,17H,8-9H2 |
| InChIKey | UBUUYGHXAXDPHR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |