C12H11NO2 — CID 67816809
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrrole (PubChem CID 67816809) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrrole.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrrole |
|---|---|
| PubChem CID | 67816809 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrrole |
| SMILES | c1c[nH]c(-c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C12H11NO2/c1-2-10(13-5-1)9-3-4-11-12(8-9)15-7-6-14-11/h1-5,8,13H,6-7H2 |
| InChIKey | DDNMUDQYOUUNRW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |