C13H11NO3 — CID 63750334
2,3-dihydro-1,4-benzodioxin-6-yl(1H-pyrrol-2-yl)methanone (PubChem CID 63750334) has the molecular formula C13H11NO3 and a molecular weight of 229.24 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl(1H-pyrrol-2-yl)methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 63750334 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl(1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCCO2)c1ccc[nH]1 |
| InChI | InChI=1S/C13H11NO3/c15-13(10-2-1-5-14-10)9-3-4-11-12(8-9)17-7-6-16-11/h1-5,8,14H,6-7H2 |
| InChIKey | ZBDOTQMGHRFFSC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |