C14H12ClN3O4 — CID 78813932
N'-(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 78813932) has the molecular formula C14H12ClN3O4 and a molecular weight of 321.72 g/mol. Its IUPAC name is N'-(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78813932 |
| Molecular Formula | C14H12ClN3O4 |
| Molecular Weight | 321.72 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | N'-(5-chloro-2,3-dihydro-1,4-benzodioxine-7-carbonyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc[nH]1)c1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C14H12ClN3O4/c15-9-6-8(7-11-12(9)22-5-4-21-11)13(19)17-18-14(20)10-2-1-3-16-10/h1-3,6-7,16H,4-5H2,(H,17,19)(H,18,20) |
| InChIKey | MBBUIGYGJBOKRG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.72 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|