C14H13N3O3 — CID 78851667
N'-(2,3-dihydro-1-benzofuran-5-carbonyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 78851667) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is N'-(2,3-dihydro-1-benzofuran-5-carbonyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-(2,3-dihydro-1-benzofuran-5-carbonyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78851667 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N'-(2,3-dihydro-1-benzofuran-5-carbonyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc[nH]1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H13N3O3/c18-13(16-17-14(19)11-2-1-6-15-11)10-3-4-12-9(8-10)5-7-20-12/h1-4,6,8,15H,5,7H2,(H,16,18)(H,17,19) |
| InChIKey | YFMBIVSQDKEWPG-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|